CAS 1560-93-6
:2-METHYLPENTADECANE
Description:
2-Methylpentadecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It consists of a long carbon chain with a methyl group attached to the second carbon atom, resulting in a total of 16 carbon atoms. This compound is part of the larger family of alkanes, which are saturated hydrocarbons characterized by single bonds between carbon atoms. 2-Methylpentadecane is typically a colorless liquid at room temperature and is insoluble in water due to its hydrophobic nature, but it is soluble in organic solvents. Its molecular formula is C16H34, and it exhibits typical alkane properties, such as low reactivity and stability under standard conditions. The compound has applications in various fields, including as a component in fuels and lubricants, and may also be studied for its physical and chemical properties in research settings. Its relatively high molecular weight contributes to its higher boiling point compared to shorter-chain alkanes, making it useful in specific industrial applications.
Formula:C16H34
InChI:InChI=1/C16H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(2)3/h16H,4-15H2,1-3H3
Synonyms:- NSC 109495
- 2-Methylpentadecane
- Pentadecane, 2-methyl- (8CI)(9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


