CAS 156001-51-3
:5-Bromo-2-methylbenzonitrile
Description:
5-Bromo-2-methylbenzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a cyano group (-CN) attached to a methyl-substituted benzene ring. The presence of the bromine atom introduces both electrophilic and nucleophilic reactivity, making it useful in various chemical reactions, including substitution and coupling reactions. The cyano group contributes to the compound's polarity and can participate in nucleophilic addition reactions. This compound is typically a solid at room temperature and is soluble in organic solvents such as acetone and dichloromethane, but has limited solubility in water due to its hydrophobic aromatic structure. Its applications span across pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate in the synthesis of more complex molecules. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C8H6BrN
InChI:InChI=1S/C8H6BrN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,1H3
InChI key:InChIKey=WNVUTFDOGUGEIS-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)C=CC(Br)=C1
Synonyms:- 3-Bromo-6-Methylbenzonitrile
- Benzonitrile, 5-bromo-2-methyl-
- 5-Bromo-2-methylbenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzonitrile, 5-bromo-2-methyl-
CAS:Formula:C8H6BrNPurity:97%Color and Shape:SolidMolecular weight:196.04395-Bromo-2-methylbenzonitrile
CAS:5-Bromo-2-methylbenzonitrileFormula:C8H6BrNPurity:>98%Molecular weight:196.043945-Bromo-2-methylbenzonitrile
CAS:Formula:C8H6BrNPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:196.055-Bromo-2-methylbenzonitrile
CAS:5-Bromo-2-methylbenzonitrile is a substrate for the enzyme benzoate kinase and is used as an intermediate in the synthesis of cyclen. It can be activated by addition of acid, which leads to a rapid increase in the rate of reaction. The kinetic data for this reaction have been analyzed and show that it obeys first order kinetics with respect to both 5-bromo-2-methylbenzonitrile and benzoic acid. This reaction is also catalyzed by an analog of cyclen, which binds to the enzyme more tightly than 5-bromo-2-methylbenzonitrile, resulting in a higher activation energy. It is possible to analyze the kinetics of this reaction using agarose gel electrophoresis or supercoiled DNA analysis.Formula:C8H6BrNPurity:Min. 95%Color and Shape:PowderMolecular weight:196.04 g/mol5-Bromo-2-methylbenzonitrile
CAS:Formula:C8H6BrNPurity:95%Color and Shape:SolidMolecular weight:196.0475-Bromo-2-methylbenzonitrile
CAS:5-Bromo-2-methylbenzonitrileFormula:C8H6BrNPurity:98%Molecular weight:196.04





