CymitQuimica logo

CAS 156016-33-0

:

N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide

Description:
N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide is an organic compound characterized by its functional groups and structural features. It contains an acetamide moiety, which is indicative of its potential as an amide derivative. The presence of a chloro group and a nitro group on the aromatic ring contributes to its reactivity and may influence its biological activity. The hydroxyl group adds to its polarity, potentially enhancing solubility in polar solvents. This compound is likely to exhibit specific interactions due to its functional groups, making it of interest in medicinal chemistry and research applications. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of compounds with antibacterial or anti-inflammatory properties. Additionally, the presence of halogen and nitro substituents may affect its electronic properties, influencing its reactivity in various chemical reactions. Overall, N-(5-chloro-2-hydroxy-3-nitrophenyl)acetamide is a compound with diverse potential applications, warranting further investigation into its chemical behavior and biological effects.
Formula:C8H7ClN2O4
InChI:InChI=1/C8H7ClN2O4/c1-4(12)10-6-2-5(9)3-7(8(6)13)11(14)15/h2-3,13H,1H3,(H,10,12)
SMILES:CC(=Nc1cc(cc(c1O)N(=O)=O)Cl)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.