CAS 156028-40-9

1,4-Dibromo-2,5-bis(octyloxy)benzene

Description:

1,4-Dibromo-2,5-bis(octyloxy)benzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two bromine atoms and two long-chain octyloxy groups. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions. The octyloxy groups contribute to its hydrophobic nature, which can influence its solubility in organic solvents and its potential applications in materials science, particularly in the development of organic electronic devices and liquid crystals. This compound may exhibit interesting thermal and optical properties due to its molecular structure, making it a candidate for research in advanced materials. Additionally, the presence of multiple substituents can lead to unique intermolecular interactions, affecting its physical properties such as melting and boiling points. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 1,4-Dibromo-2,5-bis(octyloxy)benzene is a versatile compound with potential applications in various fields of chemistry and materials science.

Formula: C₂₂H₃₆Br₂O₂

InChI: InChI=1S/C22H36Br2O2/c1-3-5-7-9-11-13-15-25-21-17-20(24)22(18-19(21)23)26-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3

InChI key: InChIKey=MJMCDNUIQSZJKE-UHFFFAOYSA-N

SMILES: O(CCCCCCCC)C1=C(Br)C=C(OCCCCCCCC)C(Br)=C1

Synonyms:

• 1,4-Dibromo-2,5-bis(octyloxy)benzene
• 2,5-Dibromo-1,4-dioctoxybenzene
• 1,4-Dibromo-2,5-dioctyloxybenzene
• Benzene, 1,4-dibromo-2,5-bis(octyloxy)-
• 2,5-Dioctyloxy-1,4-dibromobenzene

1,4-Dibromo-2,5-bis(octyloxy)benzene

CAS: 156028-40-9

Formula: C₂₂H₃₆Br₂O₂

Molecular weight: 492.3280

Ref: IN-DA001OH8