CymitQuimica logo

CAS 156088-46-9

:

(5S)-5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone

Description:
(5S)-5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone, with the CAS number 156088-46-9, is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered ring containing nitrogen and a carbonyl group. This compound is notable for its hydroxymethyl group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of two methyl groups at the 3-position enhances its steric properties, influencing its interactions with other molecules. As a chiral compound, it exhibits specific optical activity, which can be significant in pharmaceutical applications where stereochemistry plays a crucial role in biological activity. The compound's solubility and stability in various solvents make it a versatile intermediate in chemical reactions. Additionally, its potential use in the synthesis of more complex molecules highlights its importance in the field of organic chemistry. Overall, (5S)-5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone is a valuable compound with diverse applications in research and industry.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-7(2)3-5(4-9)8-6(7)10/h5,9H,3-4H2,1-2H3,(H,8,10)/t5-/m0/s1
InChI key:InChIKey=LAPMHIATPBRNHT-YFKPBYRVSA-N
SMILES:C(O)[C@@H]1CC(C)(C)C(=O)N1
Synonyms:
  • (5S)-5-(Hydroxymethyl)-3,3-dimethyl-2-pyrrolidinone
  • (S)-5-(Hydroxymethyl)-3,3-dimethylpyrrolidin-2-one
  • 2-Pyrrolidinone, 5-(hydroxymethyl)-3,3-dimethyl-, (S)-
  • 2-Pyrrolidinone, 5-(hydroxymethyl)-3,3-dimethyl-, (5S)-
  • (S)-4,4-Dimethyl-2-hydroxymethyl-5-oxopyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.