CAS 156126-12-4
:n-MCT
Description:
n-MCT, or medium-chain triglycerides, specifically refers to a type of fat derived from coconut oil or palm kernel oil, characterized by its medium-length fatty acid chains, typically containing 6 to 12 carbon atoms. The CAS number 156126-12-4 identifies a specific formulation of these triglycerides. n-MCT is known for its unique metabolic properties, as it is rapidly absorbed and metabolized by the liver, providing a quick source of energy. This substance is often utilized in dietary supplements, sports nutrition, and medical formulations due to its potential benefits in weight management and energy enhancement. Additionally, n-MCT is tasteless and odorless, making it suitable for incorporation into various food products. It is also recognized for its antimicrobial properties and potential to support cognitive function. Overall, n-MCT serves as a versatile ingredient in both health and culinary applications, appealing to those seeking alternative energy sources or dietary fats.
Formula:C12H16N2O4
InChI:InChI=1S/C12H16N2O4/c1-6-4-14(11(18)13-10(6)17)8-2-9(16)12(5-15)3-7(8)12/h4,7-9,15-16H,2-3,5H2,1H3,(H,13,17,18)/t7-,8+,9+,12+/m1/s1
InChI key:InChIKey=NOWRLNPOENZFHP-ARHDFHRDSA-N
SMILES:C(O)[C@]12[C@](C1)([C@H](C[C@@H]2O)N3C(=O)NC(=O)C(C)=C3)[H]
Synonyms:- (North)-methanocarbathymidine
- 2,4(1H,3H)-Pyrimidinedione, 1-[(1S,2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)bicyclo[3.1.0]hex-2-yl]-5-methyl-
- n-MCT
- 1-[(1S,2S,4S,5R)-4-Hydroxy-5-(hydroxymethyl)bicyclo[3.1.0]hex-2-yl]-5-methyl-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 1-[4-hydroxy-5-(hydroxymethyl)bicyclo[3.1.0]hex-2-yl]-5-methyl-, [1S-(1α,2α,4β,5α)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
n-MCT
CAS:Controlled ProductApplications n-MCT is an antiviral agent that is used against herpesvirus and orthopoxvirus infections.
References Prichard, M. N., et al.: Antimicrob. Agents. Chemother., 50, 1336 (2006);Formula:C12H16N2O4Color and Shape:NeatMolecular weight:252.266n-MCT-d3
CAS:Controlled ProductApplications n-MCT-d3 is the isotope labelled analog of n-MCT. n-MCT is an antiviral agent that is used against herpesvirus and orthopoxvirus infections.
References Prichard, M. N., et al.: Antimicrob. Agents. Chemother., 50, 1336 (2006);Formula:C12D3H13N2O4Color and Shape:NeatMolecular weight:255.285N-MCT
CAS:N-MCT is an analog of a naturally occurring protein found in human urine that has been shown to have potent anticancer properties. It works by inhibiting specific kinases involved in cancer cell growth and promoting apoptosis, or programmed cell death, in cancer cells. N-MCT has been studied extensively for its potential as a medicinal inhibitor of tumor growth and has shown promising results in preclinical trials. This compound has the ability to disrupt the cell cycle of cancer cells, preventing them from dividing and spreading throughout the body. Its unique mechanism of action makes it a promising candidate for future cancer therapies.Formula:C12H16N2O4Purity:Min. 95%Molecular weight:252.27 g/mol

