
CAS 156126-48-6
:1-Butanaminium, N,N,N-tributyl-, salt with 6-iodo-9H-purin-2-amine (1:1)
Description:
1-Butanaminium, N,N,N-tributyl-, salt with 6-iodo-9H-purin-2-amine (1:1) is a quaternary ammonium compound characterized by its cationic nature due to the presence of a butylammonium group. This compound features a tributylammonium moiety, which contributes to its hydrophobic properties, while the 6-iodo-9H-purin-2-amine component introduces a purine base structure, often associated with biological activity. The presence of iodine in the purine structure may enhance its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The salt formation indicates that this compound is likely to be soluble in polar solvents, which can facilitate its use in various chemical and biological applications. Additionally, the unique combination of a quaternary ammonium salt with a purine derivative suggests potential uses in drug delivery systems or as a biochemical probe. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, with implications for research in drug design and molecular biology.
Formula:C16H36N·C5H3IN5
InChI:InChI=1S/C16H36N.C5H3IN5/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-3-2-4(9-1-8-2)11-5(7)10-3/h5-16H2,1-4H3;1H,(H2-,7,8,9,10,11)/q+1;-1
InChI key:InChIKey=ULQTXQCQROFQIE-UHFFFAOYSA-N
SMILES:IC1=C2C(=NC([NH-])=N1)N=CN2.[N+](CCCC)(CCCC)(CCCC)CCCC
Synonyms:- 1-Butanaminium, N,N,N-tributyl-, salt with 6-iodo-9H-purin-2-amine (1:1)
- 1-Butanaminium, N,N,N-tributyl-, salt with 6-iodo-1H-purin-2-amine (1:1)
- 1H-Purin-2-amine, 6-iodo-, ion(1-), N,N,N-tributyl-1-butanaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Butanaminium, N,N,N-tributyl-, salt with 6-iodo-9H-purin-2-amine (1:1)
CAS:Formula:C21H39IN6Molecular weight:502.479
