CymitQuimica logo

CAS 156143-99-6

:

1,1'-dithiobis(2-amino-3-(4-(carboxymethyl)cyclohexyl)propane) bis(trifluoroacetate)

Description:
1,1'-Dithiobis(2-amino-3-(4-(carboxymethyl)cyclohexyl)propane) bis(trifluoroacetate), identified by its CAS number 156143-99-6, is a complex organic compound characterized by its dithiobis structure, which features two thiol groups linked by a disulfide bond. This compound contains amino and carboxymethyl functional groups, contributing to its potential reactivity and solubility in various solvents. The trifluoroacetate moieties enhance its stability and solubility in polar solvents, making it useful in biochemical applications. The presence of cyclohexyl groups provides steric hindrance, which can influence its interactions with other molecules. This compound may exhibit properties such as chelation, making it relevant in coordination chemistry and potential applications in drug delivery or as a biochemical probe. Its unique structure allows for specific interactions with biological targets, which can be exploited in medicinal chemistry and materials science. Overall, the compound's characteristics suggest versatility in various chemical and biological contexts.
Formula:C26H42F6N2O8S2
InChI:InChI=1/C22H40N2O4S2.2C2HF3O2/c23-19(9-15-1-5-17(6-2-15)11-21(25)26)13-29-30-14-20(24)10-16-3-7-18(8-4-16)12-22(27)28;2*3-2(4,5)1(6)7/h15-20H,1-14,23-24H2,(H,25,26)(H,27,28);2*(H,6,7)
SMILES:C1CC(CCC1CC(CSSCC(CC1CCC(CC1)CC(=O)O)N)N)CC(=O)O.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O
Synonyms:
  • Dtbacc btfac
  • 2,2'-{Disulfanediylbis[(2-Aminopropane-3,1-Diyl)Cyclohexane-4,1-Diyl]}Diacetic Acid Trifluoroacetate (1:2)
  • 1,1'-Dithiobis(2-amino-3-(4-(carboxymethyl)cyclohexyl)propane) bis(trifluoroacetate)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.