CymitQuimica logo

CAS 1562-12-5

:

1-amino-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile

Description:
1-Amino-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, with the CAS number 1562-12-5, is a heterocyclic organic compound characterized by its pyridine-like structure. This compound features a dihydropyridine ring, which is a five-membered ring containing nitrogen, and is substituted with an amino group, two methyl groups, a carbonitrile group, and a carbonyl group. The presence of the amino group contributes to its potential as a building block in pharmaceuticals, while the carbonitrile and carbonyl functionalities may enhance its reactivity and ability to participate in various chemical reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for diverse applications in medicinal chemistry, particularly in the development of compounds with potential biological activity. Additionally, the presence of multiple functional groups suggests that it may engage in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical properties.
Formula:C8H9N3O
InChI:InChI=1/C8H9N3O/c1-5-3-6(2)11(10)8(12)7(5)4-9/h3H,10H2,1-2H3
InChI key:IOUFHSGKGXNGDO-UHFFFAOYSA-N
SMILES:Cc1cc(C)n(c(=O)c1C#N)N
Found 4 products.