CymitQuimica logo

CAS 156492-30-7

:

1,10-Phenanthroline, 4,7-dibromo-

Description:
1,10-Phenanthroline, 4,7-dibromo- is a chemical compound characterized by its structure, which includes a phenanthroline backbone with bromine substituents at the 4 and 7 positions. This compound is part of the phenanthroline family, known for its chelating properties, particularly with metal ions. The presence of bromine atoms enhances its reactivity and can influence its solubility and stability in various solvents. Typically, compounds like 1,10-phenanthroline derivatives are utilized in coordination chemistry, analytical chemistry, and as ligands in metal complexes. They may exhibit interesting photophysical properties, making them useful in applications such as sensors or catalysts. Additionally, the bromine substituents can impart unique biological activities, which may be explored in medicinal chemistry. Overall, 1,10-Phenanthroline, 4,7-dibromo- is a versatile compound with potential applications across various fields of chemistry and materials science.
Formula:C12H6Br2N2
InChI:InChI=1S/C12H6Br2N2/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H
InChI key:AKZAIDYHEKUXBU-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Br)Br
Found 6 products.