CAS 1566-15-0
:Phosphoramide mustard cyclohexylamine salt
Description:
Phosphoramide mustard cyclohexylamine salt, with the CAS number 1566-15-0, is a chemical compound that belongs to the class of alkylating agents, which are known for their ability to form covalent bonds with nucleophilic sites in biological molecules, particularly DNA. This compound is characterized by its phosphoramide structure, which contributes to its reactivity and potential use in medicinal chemistry, particularly in cancer treatment. The cyclohexylamine component enhances its solubility and stability in biological systems. As an alkylating agent, it can interfere with DNA replication and transcription, leading to cytotoxic effects, which is a mechanism exploited in chemotherapy. However, its use is associated with significant toxicity and side effects, necessitating careful handling and administration. The compound's physical properties, such as solubility and stability, can vary based on environmental conditions, making it essential to consider these factors in both laboratory and therapeutic contexts. Overall, phosphoramide mustard cyclohexylamine salt exemplifies the dual nature of many chemical agents, offering therapeutic potential while posing risks that require stringent safety measures.
Formula:C10H24Cl2N3O2P
InChI:InChI=1/C6H13N.C4H11Cl2N2O2P/c7-6-4-2-1-3-5-6;5-1-3-8(4-2-6)11(7,9)10/h6H,1-5,7H2;1-4H2,(H3,7,9,10)
SMILES:C1CCC(CC1)N.C(CN(CCCl)P(=O)(N)O)Cl
Synonyms:- Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-, compd.with cyclohexanamine(1:1) (9CI)
- N,N-bis(2-chloroethyl)phosphorodiamidic acid - cyclohexanamine (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Phosphoramide Mustard (cyclohexylammonium salt)
CAS:Formula:C10H24Cl2N3O2PPurity:95.0%Color and Shape:SolidMolecular weight:320.1962Phosphamide Mustard Cyclohexanamine Salt
CAS:Formula:C4H11Cl2N2O2P·C6H13NColor and Shape:White To Off-White SolidMolecular weight:221.02 99.18Phosphoramide mustard cyclohexanamine
CAS:<p>Phosphoramide mustard cyclohexanamine</p>Purity:≥95%Molecular weight:320.2g/molPhosphamide Mustard-d8 Cyclohexamine Salt
CAS:Formula:C4H3Cl2N2O2PD8·C6H13NColor and Shape:White To Off-White SolidMolecular weight:229.07 99.18Phosphoramide mustard cyclohexanamine
CAS:<p>Phosphoramide mustard cyclohexanamine is active metabolite of cyclophosphamide, an alkylating agent that cross-links DNA strands,causes cell death, antitumor.</p>Formula:C10H24Cl2N3O2PPurity:95%Color and Shape:SolidMolecular weight:320.2N,N-Bis(2-chloroethyl)phosphorodiamidic Acid Cyclohexylamine Salt
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications N,N-Bis(2-chloroethyl)phosphorodiamidic Acid Cyclohexylamine Salt is a cytotoxic metabolite of Cyclophosphamide (C988580).<br>References Driven, H.A.A.M. et al.: Chem. BIol. Inter., 93, 185 (1994); Fenselau, C. et al.: Xenobiotica, 22, 1207 (1992);<br></p>Formula:C10H24Cl2N3O2PColor and Shape:NeatMolecular weight:320.2Phosphamide Mustard Cyclohexanamine Salt
CAS:Formula:C4H11Cl2N2O2PC6H13NMolecular weight:221.02 : 99.18






