CymitQuimica logo

CAS 1566-15-0

:

Phosphoramide mustard cyclohexylamine salt

Description:
Phosphoramide mustard cyclohexylamine salt, with the CAS number 1566-15-0, is a chemical compound that belongs to the class of alkylating agents, which are known for their ability to form covalent bonds with nucleophilic sites in biological molecules, particularly DNA. This compound is characterized by its phosphoramide structure, which contributes to its reactivity and potential use in medicinal chemistry, particularly in cancer treatment. The cyclohexylamine component enhances its solubility and stability in biological systems. As an alkylating agent, it can interfere with DNA replication and transcription, leading to cytotoxic effects, which is a mechanism exploited in chemotherapy. However, its use is associated with significant toxicity and side effects, necessitating careful handling and administration. The compound's physical properties, such as solubility and stability, can vary based on environmental conditions, making it essential to consider these factors in both laboratory and therapeutic contexts. Overall, phosphoramide mustard cyclohexylamine salt exemplifies the dual nature of many chemical agents, offering therapeutic potential while posing risks that require stringent safety measures.
Formula:C10H24Cl2N3O2P
InChI:InChI=1/C6H13N.C4H11Cl2N2O2P/c7-6-4-2-1-3-5-6;5-1-3-8(4-2-6)11(7,9)10/h6H,1-5,7H2;1-4H2,(H3,7,9,10)
InChI key:BGTIPRUDEMNRIP-UHFFFAOYSA-N
SMILES:C1CCC(CC1)N.C(CN(CCCl)P(=O)(N)O)Cl
Synonyms:
  • Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-, compd.with cyclohexanamine(1:1) (9CI)
  • N,N-bis(2-chloroethyl)phosphorodiamidic acid - cyclohexanamine (1:1)
Found 10 products.