CAS 1567-89-1: 2-Propanone, 2-(2,4-dinitrophenyl)hydrazone
Description:2-Propanone, 2-(2,4-dinitrophenyl)hydrazone, commonly known as DNP-hydrazone, is an organic compound characterized by its hydrazone functional group, which is formed from the reaction of 2,4-dinitrophenylhydrazine with acetone. This compound typically appears as a yellow to orange crystalline solid, reflecting the presence of the dinitrophenyl group, which contributes to its color and reactivity. It is known for its use in analytical chemistry, particularly in the identification and quantification of carbonyl compounds through the formation of stable hydrazones. The compound exhibits moderate solubility in organic solvents, such as ethanol and acetone, but is generally insoluble in water. Its melting point and other physical properties can vary based on purity and specific conditions. Additionally, due to the presence of the dinitrophenyl moiety, it may exhibit some degree of toxicity and should be handled with care in laboratory settings. Overall, 2-Propanone, 2-(2,4-dinitrophenyl)hydrazone serves as a valuable reagent in organic synthesis and analytical applications.
Formula:C9H10N4O4
InChI:InChI=1S/C9H10N4O4/c1-6(2)10-11-8-4-3-7(12(14)15)5-9(8)13(16)17/h3-5,11H,1-2H3
InChI key:InChIKey=YGIXYAIGWMAGIB-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C(NN=C(C)C)C(=C1)N(=O)=O
- Synonyms:
- Acetone, (2,4-dinitrophenyl)hydrazone
- 2-Propanone, 2-(2,4-dinitrophenyl)hydrazone
- 2-Propanone, (2,4-dinitrophenyl)hydrazone
- NSC 6120
- NSC 131450
