CymitQuimica logo

CAS 156801-47-7

:

2-chloro-1-(5-chloro-3-methylbenzo[b]thiophen-2-yl)ethan-1-one

Description:
2-Chloro-1-(5-chloro-3-methylbenzo[b]thiophen-2-yl)ethan-1-one, with the CAS number 156801-47-7, is a chemical compound characterized by its complex structure, which includes a chloro-substituted ethyl ketone and a benzo[b]thiophene moiety. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its aromatic and heterocyclic components. The presence of chlorine atoms contributes to its reactivity, potentially influencing its behavior in chemical reactions, such as electrophilic substitution or nucleophilic attack. The benzo[b]thiophene ring system may impart unique electronic properties, making it of interest in various fields, including pharmaceuticals and materials science. Additionally, the compound's potential biological activity could be explored in medicinal chemistry, particularly in the development of new therapeutic agents. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound represents a fascinating intersection of organic chemistry and potential application in drug discovery.
Formula:C11H8Cl2OS
InChI:InChI=1/C11H8Cl2OS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3
InChI key:MSOJRYIWMSFMDD-UHFFFAOYSA-N
SMILES:Cc1c2cc(ccc2sc1C(=O)CCl)Cl
Synonyms:
  • 2-Chloroacetyl-5-chloro-3-methylbenzo[b]thiophene
  • 2-Chloro-1-(5-Chloro-3-Methyl-1-Benzothiophen-2-Yl)Ethanone
Found 3 products.