CAS 15715-58-9

triethylammonium hydrogen carbonate buf-fer 1.0 M in water

Description:

Triethylammonium hydrogen carbonate, with the CAS number 15715-58-9, is a quaternary ammonium compound that serves as a buffering agent in various chemical and biological applications. It is characterized by its ability to maintain a stable pH in solution, making it particularly useful in biochemical assays and processes where pH fluctuations can affect the outcome. The compound is soluble in water, forming a clear solution at a concentration of 1.0 M, which indicates a relatively high concentration of the buffering species. Its buffering capacity arises from the equilibrium between the triethylammonium ion and the bicarbonate ion, allowing it to resist changes in pH upon the addition of acids or bases. Additionally, triethylammonium hydrogen carbonate is generally considered to be non-toxic and biocompatible, making it suitable for use in laboratory settings and potential applications in pharmaceuticals. However, as with all chemical substances, proper handling and safety precautions should be observed to mitigate any risks associated with its use.

Formula: C₈H₁₉NO₄

InChI: InChI=1/C6H15N.2CH2O2/c1-4-7(5-2)6-3;2*2-1-3/h4-6H2,1-3H3;2*1H,(H,2,3)

SMILES: CCN(CC)CC.C(=O)O.C(=O)O

Triethylammonium bicarbonate buffer, 1.0 M, pH = 8.5

CAS: 15715-58-9

Formula: C₇H₁₇NO₃

Color and Shape: Liquid

Molecular weight: 163.2148

Ref: IN-DA001P9R

Triethylammonium bicarbonate buffer, 1M solution

CAS: 15715-58-9

Color and Shape: Clear, colourless liquid

Ref: 7W-GB4354

Triethylammonium bicarbonate buffer 1M

CAS: 15715-58-9

Triethylammonium bicarbonate buffer 1M

Purity: volatile buffer, ~1.0 M in H2O，pH:8.5

Color and Shape: Liquid

Molecular weight: 163.21g/mol

Ref: 54-OR924189

Triethylammonium bicarbonate buffer - 1.0 M, pH 8.5±0.1

CAS: 15715-58-9

Triethylammonium bicarbonate buffer is an alkanoic acid that is a buffering agent. It has been used in wastewater treatment to lower the pH of a solution, as well as in analytical methods to control the pH of a solution. The matrix effect of this buffer may be due to its high water permeability and low ionization constant. Triethylammonium bicarbonate buffer has been shown to inhibit the polymerase chain reaction (PCR) by binding to pim-1, which is a protein required for DNA synthesis. This compound also inhibits cell-to-cell transmission of syncytial virus infections by inhibiting nucleotide synthesis. This molecule has been shown to have glomerular filtration rate increasing properties in human serum, as well as structural analysis that reveals intramolecular hydrogen bonding between nitrogen and oxygen atoms.

Formula: C₆H₁₅N·CH₂O₃

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 163.22 g/mol

Ref: 3D-FT138890