CymitQuimica logo

CAS 15715-58-9

:

triethylammonium hydrogen carbonate buf-fer 1.0 M in water

Description:
Triethylammonium hydrogen carbonate, with the CAS number 15715-58-9, is a quaternary ammonium compound that serves as a buffering agent in various chemical and biological applications. It is characterized by its ability to maintain a stable pH in solution, making it particularly useful in biochemical assays and processes where pH fluctuations can affect the outcome. The compound is soluble in water, forming a clear solution at a concentration of 1.0 M, which indicates a relatively high concentration of the buffering species. Its buffering capacity arises from the equilibrium between the triethylammonium ion and the bicarbonate ion, allowing it to resist changes in pH upon the addition of acids or bases. Additionally, triethylammonium hydrogen carbonate is generally considered to be non-toxic and biocompatible, making it suitable for use in laboratory settings and potential applications in pharmaceuticals. However, as with all chemical substances, proper handling and safety precautions should be observed to mitigate any risks associated with its use.
Formula:C8H19NO4
InChI:InChI=1/C6H15N.2CH2O2/c1-4-7(5-2)6-3;2*2-1-3/h4-6H2,1-3H3;2*1H,(H,2,3)
InChI key:AFQIYTIJXGTIEY-UHFFFAOYSA-N
SMILES:CCN(CC)CC.C(=O)O.C(=O)O
Found 6 products.