CymitQuimica logo

CAS 1572-46-9

:

9-Benzylfluorene

Description:
9-Benzylfluorene is an organic compound characterized by its structure, which consists of a fluorene backbone with a benzyl group attached at the 9-position. This compound is typically a white to pale yellow solid at room temperature and is known for its relatively high melting point. It is non-polar and exhibits hydrophobic properties, making it soluble in organic solvents such as benzene, toluene, and dichloromethane, but insoluble in water. 9-Benzylfluorene is of interest in various fields, including organic chemistry and materials science, due to its potential applications in organic light-emitting diodes (OLEDs) and as a building block in the synthesis of more complex organic molecules. Its photophysical properties, such as fluorescence, make it useful in studies related to photochemistry and photophysics. Additionally, it can undergo various chemical reactions, including electrophilic substitutions and polymerization, which further enhances its utility in synthetic organic chemistry. Safety data indicates that, like many organic compounds, it should be handled with care to avoid inhalation or skin contact.
Formula:C20H16
InChI:InChI=1/C20H16/c1-2-8-15(9-3-1)14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20H,14H2
InChI key:ZBQLAOVNDBNMFI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CC1c2ccccc2c2ccccc12
Synonyms:
  • 9-benzyl-9H-fluorene
Found 3 products.