CymitQuimica logo

CAS 1572414-83-5

:

ML-323

Description:
ML-323, identified by its CAS number 1572414-83-5, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. While specific characteristics such as molecular weight, structure, and solubility may vary, ML-323 is typically characterized by its role as a selective inhibitor of certain biological pathways, which may contribute to its efficacy in treating various diseases. The compound's mechanism of action often involves modulation of protein interactions or enzymatic activity, making it a subject of interest in drug discovery and development. Additionally, ML-323 may exhibit specific pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems. As with many investigational compounds, ongoing research is essential to fully elucidate its biological effects, safety profile, and potential therapeutic uses. Always refer to the latest scientific literature for the most current and detailed information regarding this compound.
Formula:C23H24N6
InChI:InChI=1S/C23H24N6/c1-16(2)20-6-4-5-7-21(20)23-24-14-17(3)22(27-23)25-15-18-8-10-19(11-9-18)29-13-12-26-28-29/h4-14,16H,15H2,1-3H3,(H,24,25,27)
InChI key:VUIRVWPJNKZOSS-UHFFFAOYSA-N
SMILES:CC1=CN=C(N=C1NCC2=CC=C(C=C2)N3C=CN=N3)C4=CC=CC=C4C(C)C
Found 7 products.