CymitQuimica logo

CAS 15728-26-4

:

2-(3-METHYLBENZYLIDENE)-MALONONITRILE

Description:
2-(3-Methylbenzylidene)-malononitrile, commonly referred to by its CAS number 15728-26-4, is an organic compound characterized by its unique structure, which includes a malononitrile moiety and a substituted benzylidene group. This compound typically appears as a solid at room temperature and is known for its vibrant color and potential applications in organic synthesis and materials science. It features a conjugated system that can exhibit interesting optical properties, making it of interest in the field of dyes and pigments. The presence of the malononitrile functional groups contributes to its reactivity, particularly in nucleophilic addition reactions. Additionally, the methyl substitution on the benzylidene ring can influence its electronic properties and steric hindrance, affecting its reactivity and interaction with other chemical species. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, this compound is a valuable subject of study in organic chemistry and materials research.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c1-9-3-2-4-10(5-9)6-11(7-12)8-13/h2-6H,1H3
InChI key:VZUIMBZTZJCXIV-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)C=C(C#N)C#N
Synonyms:
  • Rarechem Al Bx 0073
Found 3 products.