CAS 15743-44-9
:Potassium glycinate
Description:
Potassium glycinate is an inorganic compound that serves as a salt formed from the amino acid glycine and potassium. It is characterized by its white crystalline appearance and is highly soluble in water, making it useful in various applications, particularly in biochemistry and nutrition. The compound is often utilized as a source of potassium in dietary supplements and as a buffering agent in biochemical assays. Potassium glycinate is known for its low toxicity and is generally regarded as safe for consumption in appropriate amounts. Its chemical structure includes a potassium ion (K+) and a glycinate ion (C2H4NNaO2), which contributes to its properties as a chelating agent. Additionally, it plays a role in maintaining osmotic balance and is involved in various metabolic processes. Due to its compatibility with biological systems, potassium glycinate is also explored in agricultural applications as a nutrient for plants. Overall, its versatility and safety profile make it a valuable compound in both health and scientific research contexts.
Formula:C2H5NO2·K
InChI:InChI=1S/C2H5NO2.K/c3-1-2(4)5;/h1,3H2,(H,4,5);
InChI key:InChIKey=DXDTUQXKMVJYAM-UHFFFAOYSA-N
SMILES:C(CN)(O)=O.[K]
Synonyms:- Glycine, potassium salt (1:1)
- Glycine, monopotassium salt
- Potassium aminoacetate
- Glycine potassium salt
- Potassium glycinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
