CAS 15793-48-3
:5-chloro-2-ethoxyaniline
Description:
5-Chloro-2-ethoxyaniline is an organic compound characterized by the presence of an aniline group substituted with a chloro and an ethoxy group. Its molecular structure features a benzene ring with an amino group (-NH2) and a chloro group (-Cl) at the 5-position, and an ethoxy group (-OCH2CH3) at the 2-position. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in dye synthesis and as an intermediate in organic synthesis. The presence of the chloro substituent can influence its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the ethoxy group enhances its solubility in organic solvents, which can be advantageous for certain applications. As with many aniline derivatives, safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C8H10ClNO
InChI:InChI=1/C8H10ClNO/c1-2-11-8-4-3-6(9)5-7(8)10/h3-5H,2,10H2,1H3
SMILES:CCOc1ccc(cc1N)Cl
Synonyms:- Benzenamine, 5-chloro-2-ethoxy-
- 5-Chloro-2-ethoxyaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-ethoxyaniline
CAS:5-Chloro-2-ethoxyanilineFormula:C8H10ClNOPurity:96%Molecular weight:171.62Benzenamine, 5-chloro-2-ethoxy-
CAS:Formula:C8H10ClNOPurity:95%Color and Shape:LiquidMolecular weight:171.62415-Chloro-2-ethoxyaniline
CAS:5-Chloro-2-ethoxyanilineFormula:C8H10ClNOPurity:95%Molecular weight:171.625-Chloro-2-ethoxy-phenylamine
CAS:5-Chloro-2-ethoxy-phenylamine is an enzyme inhibitor that binds to the active site of glucocerebrosidase, the enzyme that catalyzes the hydrolysis of glucocerebroside to glucose and ceramide. This compound has been shown to be a selective inhibitor against this enzyme and not affect other hydrolases or chaperones. It was also found that 5-chloro-2-ethoxy-phenylamine can act as a chemical chaperone by stabilizing protein folding in vitro. 5-Chloro-2-ethoxy phenylamine is a new analogue of 3-(3,4,-dichlorophenyl)-1-[(1R,2S)-2-(5,6,-dichloropyridin-3 yl)ethenyl]-1H-pyrazole. It is an inhibitor of Gaucher disease caused by gluFormula:C8H10ClNOPurity:Min. 95%Molecular weight:171.63 g/mol




