CymitQuimica logo

CAS 158401-51-5

:

3-({2-[(2-chloroethyl)amino]ethyl}amino)propyl dihydrogen phosphate dihydrochloride

Description:
3-({2-[(2-chloroethyl)amino]ethyl}amino)propyl dihydrogen phosphate dihydrochloride, with the CAS number 158401-51-5, is a chemical compound that features a complex structure incorporating both phosphate and amine functional groups. This substance is characterized by its dual functionality, which includes a dihydrogen phosphate moiety that contributes to its potential as a phosphate donor and a dihydrochloride form that enhances its solubility in aqueous environments. The presence of the chloroethyl group suggests potential reactivity, particularly in biological systems, where it may interact with nucleophiles. The compound is likely to exhibit properties typical of both phosphates and amines, such as being hygroscopic and having the ability to form salts. Its application may extend to fields such as medicinal chemistry, where it could serve as a precursor or intermediate in the synthesis of pharmaceuticals. Safety and handling precautions are essential due to the presence of chlorine and the potential for biological activity.
Formula:C7H20Cl3N2O4P
InChI:InChI=1/C7H18ClN2O4P.2ClH/c8-2-4-10-6-5-9-3-1-7-14-15(11,12)13;;/h9-10H,1-7H2,(H2,11,12,13);2*1H
InChI key:OTNQBDJOMAOTIE-UHFFFAOYSA-N
SMILES:C(CNCCNCCCl)COP(=O)(O)O.Cl.Cl
Found 12 products.