CymitQuimica logo

CAS 1588-83-6

:

4-Amino-3-nitrobenzoic acid

Description:
4-Amino-3-nitrobenzoic acid, also known as p-amino-3-nitrobenzoic acid, is an aromatic compound characterized by the presence of both an amino group (-NH2) and a nitro group (-NO2) attached to a benzoic acid structure. Its molecular formula is C7H6N2O3, indicating it contains seven carbon atoms, six hydrogen atoms, two nitrogen atoms, and three oxygen atoms. This compound typically appears as a yellow crystalline solid and is soluble in water, particularly at elevated temperatures. It exhibits acidic properties due to the carboxylic acid group (-COOH), allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 4-Amino-3-nitrobenzoic acid is often used in the synthesis of dyes, pharmaceuticals, and as an intermediate in organic synthesis. Additionally, it can serve as a reagent in analytical chemistry for the detection of certain metal ions. Its handling requires caution due to potential toxicity and environmental impact, necessitating appropriate safety measures during use.
Formula:C7H6N2O4
InChI:InChI=1S/C7H6N2O4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,8H2,(H,10,11)
InChI key:InChIKey=ZZNAYFWAXZJITH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(C(O)=O)=CC=C1N
Synonyms:
  • 3-Nitro-4-aminobenzoic acid
  • 4-Amino-3-Nitro-Benzoic Acid
  • 4-Amino-3-Nitrobenzoate
  • 4-Carboxy-2-nitroaniline
  • Benzoic acid, 4-amino-3-nitro-
  • NSC 20673
  • 4-Amino-3-nitrobenzoic acid
Found 7 products.