CAS 158920-11-7
:6,7-DIBROMO-4-METHOXY-1H-INDOLE
Description:
6,7-Dibromo-4-methoxy-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two bromine atoms at the 6 and 7 positions enhances its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. The methoxy group at the 4 position contributes to its solubility and can influence its electronic properties, making it a useful intermediate in organic synthesis. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various functionalizations, making it a versatile building block in the development of pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the presence of the halogen substituents, which can affect its interaction with biological targets. Overall, 6,7-dibromo-4-methoxy-1H-indole is a significant compound in research and development within the fields of organic and medicinal chemistry.
Formula:C9H7Br2NO
InChI:InChI=1S/C9H7Br2NO/c1-13-7-4-6(10)8(11)9-5(7)2-3-12-9/h2-4,12H,1H3
InChI key:WTWQKKHLJQVITE-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C2=C1C=CN2)Br)Br
Synonyms:- 6,7-Dibromo-4-Methyloxyindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
