CymitQuimica logo

CAS 159087-40-8

:

1,3,2-Dioxaborolane, 2-(1-hexynyl)-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-(1-hexynyl)-4,4,5,5-tetramethyl- is an organoboron compound characterized by its dioxaborolane ring structure, which features a five-membered cyclic arrangement containing two boron atoms and two oxygen atoms. This compound is notable for its functionalization with a hexynyl group, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds. The presence of tetramethyl substituents enhances its steric bulk, influencing its chemical behavior and stability. Typically, compounds of this nature exhibit properties such as solubility in organic solvents, and they may participate in various chemical reactions, including nucleophilic attacks and cross-coupling reactions. The unique structural features of 1,3,2-Dioxaborolane derivatives make them valuable intermediates in the synthesis of pharmaceuticals, agrochemicals, and materials science. Safety and handling considerations are essential due to the reactivity of boron-containing compounds, and appropriate precautions should be taken during their use in laboratory settings.
Formula:C12H21BO2
InChI:InChI=1S/C12H21BO2/c1-6-7-8-9-10-13-14-11(2,3)12(4,5)15-13/h6-8H2,1-5H3
InChI key:RYRRXQHUSGAWQX-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C#CCCCC
Found 2 products.