CymitQuimica logo

CAS 15932-93-1

:

3-hydroxycyclobutan-1-one

Description:
3-Hydroxycyclobutan-1-one, with the CAS number 15932-93-1, is a cyclic ketone characterized by a four-membered carbon ring containing a hydroxyl group and a carbonyl group. This compound exhibits a unique structural configuration that influences its chemical reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, which can affect its solubility in polar solvents. Additionally, the carbonyl group makes it susceptible to nucleophilic attack, allowing for various chemical transformations. 3-Hydroxycyclobutan-1-one may be used in organic synthesis and could serve as an intermediate in the production of more complex molecules. Its stability and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound is of interest in both academic research and potential industrial applications due to its unique structural features and reactivity profile.
Formula:C4H6O2
InChI:InChI=1S/C4H6O2/c5-3-1-4(6)2-3/h3,5H,1-2H2
InChI key:VYZHGWJPDGIYDR-UHFFFAOYSA-N
SMILES:C1C(CC1=O)O
Found 4 products.