CAS 159496-14-7
:Guanosine-1′,2′,3′,4′,5′-13C5
Description:
Guanosine-1′,2′,3′,4′,5′-13C5 is a stable isotope-labeled form of guanosine, a nucleoside composed of the nitrogenous base guanine and the sugar ribose. The designation "13C5" indicates that five carbon atoms in the ribose moiety are isotopically enriched with carbon-13, a non-radioactive isotope of carbon. This labeling is often utilized in various biochemical and metabolic studies to trace the incorporation of carbon into biological molecules. Guanosine itself plays a crucial role in cellular processes, including energy transfer (as part of GTP), signal transduction, and as a building block for RNA synthesis. The presence of carbon-13 allows researchers to utilize techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry to study metabolic pathways and molecular interactions with enhanced precision. The compound is typically used in research settings, particularly in studies involving nucleic acids, metabolism, and cellular signaling. Its CAS number, 159496-14-7, uniquely identifies this specific isotopically labeled compound in chemical databases.
Formula:C10H13N5O5
InChI:InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1/i1+1,3+1,5+1,6+1,9+1
InChI key:InChIKey=NYHBQMYGNKIUIF-JGIZTUKCSA-N
SMILES:O=C1C2=C(N(C=N2)[13C@@H]3O[13C@H]([13CH2]O)[13C@@H](O)[13C@H]3O)NC(N)=N1
Synonyms:- Guanosine-1′,2′,3′,4′,5′-13C5
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
