CAS 15958-92-6: bradykinin fragment 1-8
Description:Bradykinin fragment 1-8, also known as BK(1-8), is a peptide derived from the larger bradykinin molecule, which is a potent vasodilator involved in various physiological processes, including inflammation and pain response. This fragment consists of the first eight amino acids of bradykinin, specifically the sequence Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe. It retains some biological activity, influencing vascular permeability and modulating pain sensation. The CAS number 15958-92-6 uniquely identifies this compound in chemical databases. Bradykinin fragment 1-8 is typically characterized by its relatively small size, hydrophilic nature, and ability to interact with specific receptors in the body, such as the bradykinin B2 receptor. Its role in physiological processes makes it a subject of interest in pharmacological research, particularly in the context of cardiovascular health and pain management. Additionally, due to its peptide nature, it may be sensitive to enzymatic degradation, which can affect its stability and bioavailability in therapeutic applications.
Formula:C44H61N11O10
InChI:InChI=1/C44H61N11O10/c45-29(15-7-19-48-44(46)47)40(61)55-22-10-18-35(55)42(63)54-21-8-16-33(54)38(59)49-25-36(57)50-30(23-27-11-3-1-4-12-27)37(58)52-32(26-56)41(62)53-20-9-17-34(53)39(60)51-31(43(64)65)24-28-13-5-2-6-14-28/h1-6,11-14,29-35,56H,7-10,15-26,45H2,(H,49,59)(H,50,57)(H,51,60)(H,52,58)(H,64,65)(H4,46,47,48)/t29-,30-,31-,32-,33-,34-,35-/m0/s1
- Synonyms:
- (Des-Arg9)-Bradykinin
- H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-OH
- N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-L-phenylalanine