CAS 15959-93-0
:2-Amino-4,4,4-trifluorobutyric acid
Description:
2-Amino-4,4,4-trifluorobutyric acid, with the CAS number 15959-93-0, is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a butyric acid backbone. This compound is a derivative of butyric acid, where three hydrogen atoms on the carbon adjacent to the carboxylic acid group are replaced by fluorine atoms, resulting in enhanced polarity and potential biological activity. It typically appears as a white crystalline solid and is soluble in water due to its polar functional groups. The trifluoromethyl group imparts unique electronic properties, making it of interest in various fields, including medicinal chemistry and agrochemicals. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. Additionally, the presence of fluorine atoms can enhance metabolic stability and lipophilicity, which are important factors in drug design. Overall, 2-Amino-4,4,4-trifluorobutyric acid is a compound of interest for its potential applications in pharmaceuticals and chemical synthesis.
Formula:C4H7ClF3NO2
InChI:InChI=1/C4H6F3NO2.ClH/c5-4(6,7)1-2(8)3(9)10;/h2H,1,8H2,(H,9,10);1H
SMILES:C(C(C(=O)O)N)C(F)(F)F.Cl
Synonyms:- 2-Amino-4,4,4-Trifluorobutanoic Acid Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-4,4,4-trifluorobutyric acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H6F3NO2Purity:97%Color and Shape:White to cream to pale yellow, Crystals or powder or crystalline powderMolecular weight:157.092-Amino-4,4,4-trifluorobutyric acid
CAS:2-Amino-4,4,4-trifluorobutyric acidFormula:C4H6F3NO2Purity:97%Color and Shape:White Solid-PowderMolecular weight:157.09114Butanoic acid, 2-amino-4,4,4-trifluoro-
CAS:Formula:C4H6F3NO2Purity:97%Color and Shape:SolidMolecular weight:157.09112-Amino-4,4,4-trifluorobutyric acid
CAS:Formula:C4H6F3NO2Purity:97%Color and Shape:CrystallineMolecular weight:157.092



