CymitQuimica logo

CAS 15988-11-1

:

4-Phenyl-1,2,4-triazolidine-3,5-dione

Description:
4-Phenyl-1,2,4-triazolidine-3,5-dione, with the CAS number 15988-11-1, is a heterocyclic organic compound characterized by its triazolidine ring structure, which contains three nitrogen atoms and two carbonyl groups. This compound typically appears as a crystalline solid and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the phenyl group contributes to its lipophilicity, which can influence its interaction with biological targets. The triazolidine moiety is often associated with various pharmacological properties, including anti-inflammatory and antimicrobial activities. Additionally, the compound may exhibit tautomeric forms due to the presence of the carbonyl groups, which can affect its reactivity and stability. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, 4-Phenyl-1,2,4-triazolidine-3,5-dione is of interest in both synthetic organic chemistry and pharmaceutical research.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-5H,(H,9,12)(H,10,13)
InChI key:InChIKey=GOSUFRDROXZXLN-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)NN1)C2=CC=CC=C2
Synonyms:
  • 1,2,4-Triazolidine-3,5-dione, 4-phenyl-
  • 4-Phenyl Urazole
  • 4-Phenyl-1,2,4-triazolidine-3,5-dione
  • Bicarbamimide, N-phenyl-
  • NSC 93432
  • 4-Phenylurazole
Found 6 products.