CAS 159944-99-7

Methyl-2-C-(trifluoromethyl)-alpha-D-ribofuranoside-3,5-diacetate

Description:

Methyl-2-C-(trifluoromethyl)-alpha-D-ribofuranoside-3,5-diacetate is a chemical compound characterized by its ribofuranoside structure, which is a sugar derivative. The presence of the trifluoromethyl group indicates that it has enhanced lipophilicity and potential biological activity, making it of interest in medicinal chemistry. The diacetate groups at the 3 and 5 positions suggest that the compound is acetylated, which can influence its solubility and reactivity. This compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit specific optical activity due to its chiral centers. Its applications may include use in synthetic organic chemistry, particularly in the synthesis of nucleoside analogs or other biologically relevant molecules. The trifluoromethyl group can also impart unique electronic properties, potentially affecting the compound's interaction with biological targets. As with many fluorinated compounds, it may exhibit stability under various conditions, making it suitable for diverse chemical applications.

Formula: C₁₁H₁₅F₃O₇

InChI: InChI=1S/C11H15F3O7/c1-5(15)19-4-7-8(20-6(2)16)10(17,11(12,13)14)9(18-3)21-7/h7-9,17H,4H2,1-3H3/t7-,8-,9+,10-/m1/s1

InChI key: IDTZCXKLMCPWNT-DOLQZWNJSA-N

SMILES: CC(=O)OC[C@@H]1[C@H]([C@@]([C@H](O1)OC)(C(F)(F)F)O)OC(=O)C

Synonyms:

• Methyl 2-C-(Trifluoromethyl)-Alpha-D-Ribofuranoside
• METHYL-2-C-(TRIFLUOROMETHYL)-α-D-RIBOFURANOSIDE-3,5-DIACETATE

Methyl 3,5-di-O-acetyl-2-C-(trifluoromethyl)-a-D-ribofuranoside

CAS: 159944-99-7

Methyl 3,5-di-O-acetyl-2-C-(trifluoromethyl)-a-D-ribofuranoside is a modified sugar that is synthesized from the monosaccharide D-ribose. This sugar can be oxidized by the enzyme glycosyltransferase to produce the polymer poly(β--D--ribofuranosyl)glycine. It can also be methylated by OMT to produce the compound methyl 3,5-di-O-acetyl-2-(trifluoromethyl)-a-(D--ribofuranoside). Methylation and glycosylation are two common modifications of sugars. Methyl 3,5-di-O-acetyl 2-(trifluoromethyl)-a-(D--ribofuranoside) is used in click chemistry as an artificial substrate for copper catalysis. The copper complex binds to

Formula: C₁₁H₁₅F₃O₇

Purity: Min. 95%

Molecular weight: 316.23 g/mol

Ref: 3D-MM03968

α-D-Ribofuranoside, methyl 2-C-(trifluoromethyl)-, 3,5-diacetate

CAS: 159944-99-7

Formula: C₁₁H₁₅F₃O₇

Molecular weight: 316.2278

Ref: IN-DA001RIQ