CymitQuimica logo

CAS 159999-80-1

:

N-benzyl-N-Boc-L-alanine

Description:
N-benzyl-N-Boc-L-alanine is a chemical compound characterized by its structure, which includes a benzyl group and a tert-butoxycarbonyl (Boc) protecting group attached to the amino acid L-alanine. This compound is typically used in organic synthesis and peptide chemistry, particularly for the protection of amino groups during the synthesis of peptides. The Boc group is a common protecting group that can be easily removed under mild acidic conditions, making it advantageous for sequential reactions. N-benzyl-N-Boc-L-alanine is generally a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. Its molecular structure contributes to its stability and reactivity, allowing it to participate in various coupling reactions. The presence of the benzyl group enhances its lipophilicity, which can influence its interaction in biological systems. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C15H21NO4
InChI:InChI=1S/C15H21NO4/c1-11(13(17)18)16(14(19)20-15(2,3)4)10-12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3,(H,17,18)/t11-/m0/s1
InChI key:MYGPVQDUOSMACR-NSHDSACASA-N
SMILES:C[C@@H](C(=O)O)N(CC1=CC=CC=C1)C(=O)OC(C)(C)C
Found 4 products.