CymitQuimica logo

CAS 16013-07-3

:

3-(4-Bromophenyl)-1,2,4-oxadiazole

Description:
3-(4-Bromophenyl)-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 4-bromophenyl group enhances its chemical properties, contributing to its potential applications in various fields, including pharmaceuticals and materials science. This compound typically exhibits a solid state at room temperature and may have moderate solubility in organic solvents. Its molecular structure suggests potential for engaging in various chemical reactions, such as electrophilic substitutions due to the electron-withdrawing nature of the bromine atom. Additionally, the oxadiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. The compound's stability, reactivity, and potential toxicity should be evaluated in specific contexts, particularly when considering its use in research or industrial applications. Overall, 3-(4-Bromophenyl)-1,2,4-oxadiazole represents a versatile structure with significant implications in chemical synthesis and biological activity.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-7-3-1-6(2-4-7)8-10-5-12-11-8/h1-5H
InChI key:InChIKey=OOQNOWMRFJKXTC-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=C1)C=2N=CON2
Synonyms:
  • 1,2,4-Oxadiazole, 3-(4-bromophenyl)-
  • 1,2,4-Oxadiazole, 3-(p-bromophenyl)-
  • 3-(4-Bromophenyl)-1,2,4-oxadiazole 96%
  • 3-(4-Bromophenyl)-1,2,4-oxadiazole
Found 3 products.