CymitQuimica logo

CAS 160549-11-1

:

2-Deoxy-3,4,6-tris-O-(phenylmethyl)-<span class="text-smallcaps">D</span>-arabino-hexopyranose

Description:
2-Deoxy-3,4,6-tris-O-(phenylmethyl)-D-arabino-hexopyranose is a carbohydrate derivative characterized by its unique structural features. It is a hexopyranose, specifically a deoxy sugar, which means it lacks an oxygen atom at the 2-position of the sugar ring. The presence of three phenylmethyl (benzyl) groups at the 3, 4, and 6 positions enhances its hydrophobic character and can influence its solubility and reactivity. This compound is typically used in organic synthesis and carbohydrate chemistry, often serving as a building block for more complex molecules. Its stereochemistry, particularly the D-arabino configuration, plays a crucial role in determining its biological activity and interactions. The compound's CAS number, 160549-11-1, allows for its identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and biochemistry. Overall, its structural complexity and functional groups make it a valuable compound for further study and application in synthetic chemistry.
Formula:C27H30O5
InChI:InChI=1S/C27H30O5/c28-26-16-24(30-18-22-12-6-2-7-13-22)27(31-19-23-14-8-3-9-15-23)25(32-26)20-29-17-21-10-4-1-5-11-21/h1-15,24-28H,16-20H2/t24-,25-,26?,27+/m1/s1
InChI key:InChIKey=PDGHLARNGSMEJE-GWDBROLASA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](OCC3=CC=CC=C3)CC(O)O[C@@H]2COCC4=CC=CC=C4
Synonyms:
  • D-arabino-Hexopyranose, 2-deoxy-3,4,6-tris-O-(phenylmethyl)-
  • 2-Deoxy-3,4,6-tris-O-(phenylmethyl)-D-arabino-hexopyranose
  • 3,4,6-Tri-
  • O<
  • (4R,5S,6R)-4,5-BIS(BENZYLOXY)-6-((BENZYLOXY)METHYL)TETRAHYDRO-2H-PYRAN-2-OL
  • 3,4,6-Tri-O-benzyl-2-deoxy-D-glucopyranose 95%
Found 3 products.