CAS 160591-91-3
:4-Chloro-2-fluorophenylboronic acid
Description:
4-Chloro-2-fluorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both chlorine and fluorine atoms. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is a characteristic feature of boronic acids due to their ability to form hydrogen bonds. The presence of the chlorine and fluorine substituents can influence its reactivity and interactions, making it useful in various chemical applications, including in the synthesis of pharmaceuticals and agrochemicals. Boronic acids are known for their ability to form reversible complexes with diols, which is significant in the development of sensors and in organic synthesis. Additionally, 4-Chloro-2-fluorophenylboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, making it a valuable intermediate in the construction of complex organic molecules. Its unique electronic properties and reactivity profile make it an important compound in medicinal chemistry and materials science.
Formula:C6H5BClFO2
InChI:InChI=1/C6H5BClFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H
SMILES:c1cc(c(cc1Cl)F)B(O)O
Synonyms:- Akos Brn-0717
- 4-Chloro-2-Fluorobenzeneboronic Acid
- 4-Chloro-2-fluorobenzeneboronic acid 98%
- 4-Chloro-2-fluorobenzeneboronicacid98%
- 4-Chloro-2-Fluorobenzenboronic Acid
- 4-CHLORO-2-FLUOROPHENYLBORONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-2-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BClFO2Purity:97.0 to 112.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:174.364-Chloro-2-fluorobenzeneboronic acid, 97%
CAS:Used as intermediates for pharmaceutical and agrochemicals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference hasFormula:C6H5BClFO2Purity:97%Color and Shape:Crystals or powder or crystalline powder, White to pale creamMolecular weight:174.36Boronic acid, B-(4-chloro-2-fluorophenyl)-
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:SolidMolecular weight:174.36514-Chloro-2-fluorobenzeneboronic acid
CAS:4-Chloro-2-fluorobenzeneboronic acidFormula:C6H5BClFO2Purity:97%Color and Shape:White SolidMolecular weight:174.36514-Chloro-2-fluorobenzeneboronic acid
CAS:Formula:C6H5BClFO2Purity:97%Color and Shape:Solid, Off-white solidMolecular weight:174.36




