CymitQuimica logo

CAS 160818-32-6

:

(3-methylpyrazin-2-yl)methanol

Description:
(3-Methylpyrazin-2-yl)methanol is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) attached to the pyrazine, specifically at the 2-position, and a methyl group (-CH3) at the 3-position of the pyrazine ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the pyrazine moiety may impart specific biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for further derivatization, which could enhance its properties or lead to novel applications. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c1-5-6(4-9)8-3-2-7-5/h2-3,9H,4H2,1H3
InChI key:PIDARGGCVNDISL-UHFFFAOYSA-N
SMILES:CC1=NC=CN=C1CO
Found 3 products.