CAS 1609395-29-0

6′-Methoxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3′-yl 2-fluoro-5-nitrobenzoate

Description:

6′-Methoxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3′-yl 2-fluoro-5-nitrobenzoate is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of isobenzofuran and xanthenes. This compound features a methoxy group, contributing to its potential solubility and reactivity, as well as a nitro group that may enhance its electronic properties and reactivity. The presence of a fluoro substituent suggests increased lipophilicity and potential bioactivity, making it of interest in medicinal chemistry. Its structure may allow for various interactions with biological targets, potentially leading to applications in pharmaceuticals or materials science. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, the unique combination of functional groups and structural features positions this compound as a candidate for further research in various chemical and biological applications.

Formula: C₂₈H₁₆FNO₈

InChI: InChI=1S/C28H16FNO8/c1-35-16-7-9-21-24(13-16)37-25-14-17(36-26(31)19-12-15(30(33)34)6-11-23(19)29)8-10-22(25)28(21)20-5-3-2-4-18(20)27(32)38-28/h2-14H,1H3

InChI key: InChIKey=DSIXXPVOZGCMEC-UHFFFAOYSA-N

SMILES: O=C1OC2(C=3C(OC=4C2=CC=C(OC)C4)=CC(OC(=O)C5=CC(N(=O)=O)=CC=C5F)=CC3)C=6C1=CC=CC6

Synonyms:

• Benzoic acid, 2-fluoro-5-nitro-, 6′-methoxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3′-yl ester
• 6′-Methoxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3′-yl 2-fluoro-5-nitrobenzoate

DSP-1

CAS: 1609395-29-0

Ref: 7W-GW5435