CymitQuimica logo

CAS 1609401-27-5

:

1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-N-methyl-, hydrochloride (1:1)

Description:
1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which contributes to its heterocyclic nature and potential biological activity. The presence of the methanamine group suggests it may exhibit amine-like reactivity, while the cyclobutyl moiety introduces a cyclic structure that can influence its steric and electronic properties. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its applicability in various chemical and pharmaceutical contexts. The compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 1609401-27-5, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications. Overall, this compound's unique structural features may contribute to its functionality in biological systems or as a precursor in synthetic chemistry.
Formula:C8H13N3O·ClH
InChI:InChI=1S/C8H13N3O.ClH/c1-9-5-7-10-8(12-11-7)6-3-2-4-6;/h6,9H,2-5H2,1H3;1H
InChI key:InChIKey=IDBAHSOOORIFQD-UHFFFAOYSA-N
SMILES:C(NC)C=1N=C(ON1)C2CCC2.Cl
Synonyms:
  • 1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-N-methyl-, hydrochloride (1:1)
Found 1 products.