CymitQuimica logo

CAS 1609406-59-8

:

1-Propanamine, N-methyl-3-[(4-methylphenyl)thio]-, hydrochloride (1:1)

Description:
1-Propanamine, N-methyl-3-[(4-methylphenyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of the N-methyl group indicates that it is a tertiary amine, while the thioether linkage with a 4-methylphenyl group suggests it may exhibit unique properties related to its steric and electronic environment. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding, affecting its solubility and interaction with biological targets. Safety and handling precautions should be observed, as with all amines and their derivatives, due to potential toxicity and reactivity.
Formula:C11H17NS·ClH
InChI:InChI=1S/C11H17NS.ClH/c1-10-4-6-11(7-5-10)13-9-3-8-12-2;/h4-7,12H,3,8-9H2,1-2H3;1H
InChI key:InChIKey=KSRUSKLRKUZUAW-UHFFFAOYSA-N
SMILES:S(CCCNC)C1=CC=C(C)C=C1.Cl
Synonyms:
  • 1-Propanamine, N-methyl-3-[(4-methylphenyl)thio]-, hydrochloride (1:1)
Found 1 products.