CAS 1609409-34-8

Benzaldehyde, 4-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1)

Description:

Benzaldehyde, 4-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzaldehyde moiety linked to a piperazine derivative through an ethoxy group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The piperazine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the ethyl group on the piperazine may influence its pharmacokinetic properties, such as absorption and distribution. As with many benzaldehyde derivatives, it may exhibit aromatic properties and could participate in various chemical reactions, including electrophilic substitutions. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and related fields.

Formula: C₁₅H₂₂N₂O₂·ClH

InChI: InChI=1S/C15H22N2O2.ClH/c1-2-16-7-9-17(10-8-16)11-12-19-15-5-3-14(13-18)4-6-15;/h3-6,13H,2,7-12H2,1H3;1H

InChI key: InChIKey=NTAQONOZHIYKLL-UHFFFAOYSA-N

SMILES: O(CCN1CCN(CC)CC1)C2=CC=C(C=O)C=C2.Cl

Synonyms:

• Benzaldehyde, 4-[2-(4-ethyl-1-piperazinyl)ethoxy]-, hydrochloride (1:1)

4-[2-(4-ethyl-1-piperazinyl)ethoxy]benzaldehyde hydrochloride

CAS: 1609409-34-8

Formula: C₁₅H₂₃ClN₂O₂

Purity: 95%

Molecular weight: 298.81

Ref: 10-F361579