CymitQuimica logo

CAS 160976-02-3

:

4-Bromo-2,6-difluoroiodobenzene

Description:
4-Bromo-2,6-difluoroiodobenzene is an aromatic halogenated compound characterized by the presence of bromine, fluorine, and iodine substituents on a benzene ring. Specifically, it features a bromine atom at the para position (4) and two fluorine atoms at the meta positions (2 and 6), along with an iodine atom at the ortho position (1). This unique arrangement of halogens contributes to its chemical reactivity and physical properties. The presence of multiple halogens typically enhances the compound's lipophilicity, potentially affecting its solubility in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the halogens, which can influence its reactivity in electrophilic aromatic substitution reactions. 4-Bromo-2,6-difluoroiodobenzene is of interest in various fields, including materials science and medicinal chemistry, where halogenated compounds often serve as intermediates or active pharmaceutical ingredients. Safety precautions should be observed when handling this compound, as halogenated aromatic compounds can pose health risks and environmental concerns.
Formula:C6H2BrF2I
InChI:InChI=1/C6H2BrF2I/c7-3-1-4(8)6(10)5(9)2-3/h1-2H
InChI key:NLWAKVGODLJALJ-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1F)I)F)Br
Synonyms:
  • Bromodifluoroiodobenzene
  • 5-Bromo-1,3-Difluoro-2-Iodobenzene
  • 1-Bromo-3,5-difluoro-4-iodobenzene
Found 5 products.