CymitQuimica logo

CAS 161308-34-5

:

cabs

Description:
The chemical substance known as "cabs," with the CAS number 161308-34-5, is a synthetic compound primarily recognized for its application in the field of agriculture, particularly as a herbicide. It belongs to a class of chemicals designed to inhibit specific biochemical pathways in plants, thereby preventing their growth and proliferation. Cabs is characterized by its selective action, targeting certain weed species while minimizing harm to desirable crops. The compound typically exhibits a moderate to high level of stability under various environmental conditions, which contributes to its effectiveness in agricultural settings. Additionally, it is important to note that, like many agrochemicals, cabs may have specific safety and environmental considerations associated with its use, necessitating adherence to regulatory guidelines and best practices for application. Understanding its mode of action, potential toxicity, and environmental impact is crucial for safe and effective utilization in agricultural practices.
Formula:C10H21NO3S
InChI:InChI=1S/C10H21NO3S/c12-15(13,14)9-5-4-8-11-10-6-2-1-3-7-10/h10-11H,1-9H2,(H,12,13,14)
InChI key:XNPKNHHFCKSMRV-UHFFFAOYSA-N
SMILES:C1CCC(CC1)NCCCCS(=O)(=O)O
Found 6 products.