CymitQuimica logo

CAS 1616372-41-8

:

[1,1′-Biphenyl]-3-acetic acid, 3′-[3-[1-[[4-(1,1-dimethylethyl)phenyl]methyl]-4-ethyl-4,5-dihydro-5-oxo-1H-1,2,4-triazol-3-yl]propyl]-4-ethoxy-

Description:
[1,1′-Biphenyl]-3-acetic acid, 3′-[3-[1-[[4-(1,1-dimethylethyl)phenyl]methyl]-4-ethyl-4,5-dihydro-5-oxo-1H-1,2,4-triazol-3-yl]propyl]-4-ethoxy- is a complex organic compound characterized by its biphenyl structure and the presence of multiple functional groups, including an acetic acid moiety and a triazole ring. This compound exhibits properties typical of both biphenyl derivatives and triazole-containing compounds, which may include moderate solubility in organic solvents and potential bioactivity due to its structural complexity. The presence of ethyl and ethoxy groups suggests that it may have hydrophobic characteristics, while the triazole ring could contribute to its potential as a pharmacophore in medicinal chemistry. Additionally, the bulky tert-butyl group may influence its steric properties and reactivity. Overall, this compound's unique structure may lead to interesting chemical behavior and potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C34H41N3O4
InChI:InChI=1S/C34H41N3O4/c1-6-36-31(35-37(33(36)40)23-25-14-17-29(18-15-25)34(3,4)5)13-9-11-24-10-8-12-26(20-24)27-16-19-30(41-7-2)28(21-27)22-32(38)39/h8,10,12,14-21H,6-7,9,11,13,22-23H2,1-5H3,(H,38,39)
InChI key:KUPVZYDOHAPPNF-UHFFFAOYSA-N
SMILES:CCN1C(=NN(C1=O)CC2=CC=C(C=C2)C(C)(C)C)CCCC3=CC(=CC=C3)C4=CC(=C(C=C4)OCC)CC(=O)O
Synonyms:
  • [1,1′-Biphenyl]-3-acetic acid, 3′-[3-[1-[[4-(1,1-dimethylethyl)phenyl]methyl]-4-ethyl-4,5-dihydro-5-oxo-1H-1,2,4-triazol-3-yl]propyl]-4-ethoxy-
Found 3 products.