CAS 1616632-77-9
:2,4,6,7,8,9-Hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one
Description:
2,4,6,7,8,9-Hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one, with CAS number 1616632-77-9, is a complex organic compound characterized by its multi-cyclic structure, which includes imidazole and pyrimidine rings. This compound features multiple substituents, including phenyl and methyl groups, which contribute to its unique chemical properties and potential biological activity. The presence of these functional groups may influence its solubility, stability, and reactivity. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological applications, possibly acting as inhibitors or modulators in various biological pathways. The stereochemistry and specific arrangement of atoms in this molecule can significantly affect its interaction with biological targets, making it a subject of study in drug development. However, detailed information regarding its specific physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization.
Formula:C24H26N4O
InChI:InChI=1S/C24H26N4O/c1-18-7-5-6-10-20(18)16-28-23(29)21-17-26(15-19-8-3-2-4-9-19)13-11-22(21)27-14-12-25-24(27)28/h2-10H,11-17H2,1H3
InChI key:VLULRUCCHYVXOH-UHFFFAOYSA-N
SMILES:CC1=CC=CC=C1CN2C(=O)C3=C(CCN(C3)CC4=CC=CC=C4)N5C2=NCC5
Synonyms:- Tic-10
- On201
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one, 2,4,6,7,8,9-hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)-
CAS:Formula:C24H26N4OPurity:%Color and Shape:SolidMolecular weight:386.4894TIC10
CAS:TIC10 is a small molecule, which is sourced from a synthetic chemical library, with a novel mode of action that involves the induction of the tumor necrosis factor-related apoptosis-inducing ligand (TRAIL) pathway. This pathway is distinguished by its ability to selectively trigger apoptosis in cancer cells while sparing normal cells. TIC10 effectively crosses the blood-brain barrier, a feature that enhances its potential application in treating brain-related malignancies.
Formula:C24H26N4OPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:386.5 g/molTIC10
CAS:TIC10 (ONC-201) inactivates Akt and ERK to induce TRAIL through Foxo3a, possesses superior drug properties: delivery across the blood-brain barrier, superiorFormula:C24H26N4OPurity:99.72% - 99.98%Color and Shape:Yellow SolidMolecular weight:386.497-Benzyl-4-(2-methylbenzyl)-1,2,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(4H)-one
CAS:Controlled ProductFormula:C24H26N4OColor and Shape:NeatMolecular weight:386.4897-Benzyl-4-(2-methylbenzyl)-1,2,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(4H)-one-d7
CAS:Controlled ProductFormula:C24H19D7N4OColor and Shape:NeatMolecular weight:393.54








