CAS 1616632-77-9

2,4,6,7,8,9-Hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one

Description:

2,4,6,7,8,9-Hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one, with CAS number 1616632-77-9, is a complex organic compound characterized by its multi-cyclic structure, which includes imidazole and pyrimidine rings. This compound features multiple substituents, including phenyl and methyl groups, which contribute to its unique chemical properties and potential biological activity. The presence of these functional groups may influence its solubility, stability, and reactivity. Typically, such compounds are of interest in medicinal chemistry due to their potential pharmacological applications, possibly acting as inhibitors or modulators in various biological pathways. The stereochemistry and specific arrangement of atoms in this molecule can significantly affect its interaction with biological targets, making it a subject of study in drug development. However, detailed information regarding its specific physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization.

Formula: C₂₄H₂₆N₄O

InChI: InChI=1S/C24H26N4O/c1-18-7-5-6-10-20(18)16-28-23(29)21-17-26(15-19-8-3-2-4-9-19)13-11-22(21)27-14-12-25-24(27)28/h2-10H,11-17H2,1H3

InChI key: VLULRUCCHYVXOH-UHFFFAOYSA-N

SMILES: CC1=CC=CC=C1CN2C(=O)C3=C(CCN(C3)CC4=CC=CC=C4)N5C2=NCC5

Synonyms:

• Tic-10
• On201

TIC10

CAS: 1616632-77-9

TIC10

Formula: C₂₄H₂₆N₄O

Purity: ≥98%

Molecular weight: 386.49

Ref: 54-BUP15011

Imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one, 2,4,6,7,8,9-hexahydro-4-[(2-methylphenyl)methyl]-7-(phenylmethyl)-

CAS: 1616632-77-9

Formula: C₂₄H₂₆N₄O

Purity: %

Color and Shape: Solid

Molecular weight: 386.4894

Ref: IN-DA001VSE

ONC201

CAS: 1616632-77-9

Formula: C₂₄H₂₆N₄O

Color and Shape: Off-White Solid

Molecular weight: 386.50

Ref: 4Z-O-115001

TIC10

CAS: 1616632-77-9

TIC10 is a small molecule, which is sourced from a synthetic chemical library, with a novel mode of action that involves the induction of the tumor necrosis factor-related apoptosis-inducing ligand (TRAIL) pathway. This pathway is distinguished by its ability to selectively trigger apoptosis in cancer cells while sparing normal cells. TIC10 effectively crosses the blood-brain barrier, a feature that enhances its potential application in treating brain-related malignancies.

Formula: C₂₄H₂₆N₄O

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 386.5 g/mol

Ref: 3D-FT137727

TIC10

CAS: 1616632-77-9

Formula: C₂₄H₂₆N₄O

Molecular weight: 386.5

Ref: BE-RMCO045001

TIC10

CAS: 1616632-77-9

TIC10 (ONC-201) inactivates Akt and ERK to induce TRAIL through Foxo3a, possesses superior drug properties: delivery across the blood-brain barrier, superior

Formula: C₂₄H₂₆N₄O

Purity: 99.72% - 99.98%

Color and Shape: Yellow Solid

Molecular weight: 386.49

Ref: TM-T7001

TIC10

CAS: 1616632-77-9

Formula: C₂₄H₂₆N₄O

Purity: 99+%

Color and Shape: Solid

Molecular weight: 386.499

Ref: 10-F468373

7-Benzyl-4-(2-methylbenzyl)-1,2,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(4H)-one

Controlled Product

CAS: 1616632-77-9

Formula: C₂₄H₂₆N₄O

Color and Shape: Neat

Molecular weight: 386.489

Ref: TR-B285480

7-Benzyl-4-(2-methylbenzyl)-1,2,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(4H)-one-d7

Controlled Product

CAS: 1616632-77-9

Formula: C₂₄H₁₉D₇N₄O

Color and Shape: Neat

Molecular weight: 393.54

Ref: TR-B285482