CAS 1617-70-5: LUPENONE
Description:Lupenone, with the CAS number 1617-70-5, is a triterpenoid compound primarily derived from various plant sources, particularly those in the family of the Lamiaceae. It is characterized by its tetracyclic structure, which is typical of many triterpenes, and features a ketone functional group that contributes to its chemical reactivity and biological activity. Lupenone is often recognized for its potential pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities, making it of interest in medicinal chemistry and natural product research. The compound is typically found in essential oils and extracts from certain plants, and its presence can be indicative of the plant's therapeutic potential. In terms of physical properties, lupenone is generally a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents but has limited solubility in water. Its stability and reactivity can be influenced by environmental factors, making it a subject of study in both organic chemistry and pharmacognosy.
Formula:C30H48O
InChI:InChI=1/C30H48O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-23,25H,1,9-18H2,2-8H3
InChI key:InChIKey=GRBHNQFQFHLCHO-BHMAJAPKSA-N
SMILES:O=C1CCC2(C)C(CCC3(C)C2CCC4C5C(C(=C)C)CCC5(C)CCC43C)C1(C)C
- Synonyms:
- 18-Lupen-3-One
- 9H-Cyclopenta[a]chrysene, lup-20(29)-en-3-one deriv.
- Lup-20(29)-En-3-One
- Lup-20(30)-en-3-one
- Lupenone(Rg)
- Lupine ketene
- NSC 281807
