CAS 162042-44-6
:L371,257
Description:
L371,257, with the CAS number 162042-44-6, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized as a small molecule with a specific structure that allows it to interact with biological targets, often related to enzyme inhibition or modulation of signaling pathways. The compound may exhibit properties such as solubility in organic solvents, stability under various conditions, and a defined mechanism of action that contributes to its biological activity. Research surrounding L371,257 may include its efficacy in preclinical models, pharmacokinetics, and safety profiles, which are crucial for understanding its potential as a drug candidate. Additionally, its synthesis and characterization involve standard organic chemistry techniques, ensuring purity and consistency for further studies. As with many compounds in drug development, ongoing research is essential to fully elucidate its properties and potential applications in treating specific diseases or conditions.
Formula:C28H33N3O6
InChI:InChI=1S/C28H33N3O6/c1-19(32)29-15-11-22(12-16-29)37-23-7-8-24(26(17-23)35-2)27(33)30-13-9-21(10-14-30)31-25-6-4-3-5-20(25)18-36-28(31)34/h3-8,17,21-22H,9-16,18H2,1-2H3
InChI key:InChIKey=WDERJSQJYIJOPD-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(CO1)=CC=CC2)C3CCN(C(=O)C4=C(OC)C=C(OC5CCN(C(C)=O)CC5)C=C4)CC3
Synonyms:- 2H-3,1-Benzoxazin-2-one, 1-[1-[4-[(1-acetyl-4-piperidinyl)oxy]-2-methoxybenzoyl]-4-piperidinyl]-1,4-dihydro-
- L 371257
- Piperidine, 1-[4-[(1-acetyl-4-piperidinyl)oxy]-2-methoxybenzoyl]-4-(2-oxo-2H-3,1-benzoxazin-1(4H)-yl)-
- 1-[1-[4-[(1-Acetyl-4-piperidinyl)oxy]-2-methoxybenzoyl]-4-piperidinyl]-1,4-dihydro-2H-3,1-benzoxazin-2-one
- 1-[4-[(1-Acetyl-4-piperidinyl)oxy]-2-methoxybenzoyl]-4-(2-oxo-2H-3,1-benzoxazin-1(4H)-yl)piperidine
- 1-[1-[4-(1-acetylpiperidin-4-yl)oxy-2-methoxybenzoyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one
- L371,257
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-[1-[4-[(1-Acetyl-4-piperidinyl)oxy]-2-methoxybenzoyl]-4-piperidinyl]-1,4-dihydro-2H-3,1-benzoxazin-2-one
CAS:Formula:C28H33N3O6Purity:99%Molecular weight:507.5781L-371,257
CAS:Controlled Product<p>L-371,257 is a novel and potent oxytocin receptor antagonist. It prevents the activation of the oxytocin receptor by binding to it, thereby blocking the effects of oxytocin on the heart and other organs. L-371,257 has been shown to have a protective effect in animal models of cardiac hypertrophy and heart failure. In humans, L-371,257 has been shown to inhibit ventricular myocyte apoptosis induced by all-trans retinoic acid (ATRA) or beta-adrenergic stimulation. L-371,257 also prevents atosiban-induced pancreatic dysfunction in mice.<br>L-371,257 is a compound that belongs to a class of drugs called antagonists that are used in scientific research for studying receptor activity. The drug binds reversibly to the target receptor and blocks its activity temporarily. This drug can be administered orally and has an analytical method using high performance liquid chromatography with ultraviolet detection at 254 nm.</p>Formula:C28H33N3O6Purity:Min. 95%Molecular weight:507.59 g/molL-371,257
CAS:L-371,257 is a competitive antagonist of oxytocin receptor with pA2 of 8.4 and Ki of 19 nM. L-371,257 shows a Ki of 3.7 nM for vasopressin receptor 1a.Formula:C28H33N3O6Purity:99.79%Color and Shape:SolidMolecular weight:507.58


