CymitQuimica logo

CAS 16205-47-3

:

7-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:
7-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a methyl group at the 7-position of the pyrazolo ring and a carboxylic acid functional group at the 3-position of the pyridine ring, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmacology, as derivatives of pyrazolo-pyridine structures have been studied for various biological activities, including anti-inflammatory and analgesic effects. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-6-3-2-4-8-7(9(12)13)5-10-11(6)8/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=DKOIGMYINSXCJV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2N(N=C1)C(C)=CC=C2
Synonyms:
  • 7-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 7-methyl-
Found 5 products.