CymitQuimica logo

CAS 1621019-96-2

:

9-Mesityl-10-phenylacridinium Tetrafluoroborate

Description:
9-Mesityl-10-phenylacridinium tetrafluoroborate is a chemical compound characterized by its unique structure, which includes an acridinium core substituted with mesityl and phenyl groups. This compound is typically used in photochemical applications due to its ability to act as a photosensitizer, facilitating various photochemical reactions. The tetrafluoroborate anion contributes to its solubility in polar solvents, making it suitable for various experimental conditions. The presence of the mesityl and phenyl groups enhances its stability and alters its electronic properties, which can influence its reactivity and interaction with other molecules. Additionally, this compound may exhibit interesting photophysical properties, such as fluorescence, which can be harnessed in applications like organic light-emitting diodes (OLEDs) and sensors. Overall, 9-Mesityl-10-phenylacridinium tetrafluoroborate is a versatile compound with significant potential in both research and industrial applications, particularly in the fields of organic chemistry and materials science.
Formula:C28H24BF4N
InChI:InChI=1S/C28H24N.BF4/c1-19-17-20(2)27(21(3)18-19)28-23-13-7-9-15-25(23)29(22-11-5-4-6-12-22)26-16-10-8-14-24(26)28;2-1(3,4)5/h4-18H,1-3H3;/q+1;-1
InChI key:LGNMSOXRNBFBGX-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C5=CC=CC=C5)C
Synonyms:
  • 9-mesityl-10-phenylacridin-10-ium tetrafluoroborate
Found 5 products.