CymitQuimica logo

CAS 162107-48-4

:

(R)-2,2-Dimethyl-3-(N-Boc)-4-ethynyl-oxazolidine

Description:
(R)-2,2-Dimethyl-3-(N-Boc)-4-ethynyl-oxazolidine is a chiral oxazolidine derivative characterized by its unique structural features, including a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. The presence of the N-Boc (tert-butoxycarbonyl) group indicates that this compound is likely used as a protecting group for amines in synthetic chemistry, facilitating selective reactions. The ethynyl group contributes to the compound's reactivity, allowing for further functionalization or coupling reactions. The two methyl groups at the 2-position enhance steric hindrance, which can influence the compound's reactivity and interaction with other molecules. This compound is of interest in the field of medicinal chemistry and organic synthesis, particularly for its potential applications in the development of pharmaceuticals or as an intermediate in complex organic syntheses. Its chirality suggests that it may exhibit specific biological activity, making it a candidate for further investigation in drug development. Overall, (R)-2,2-Dimethyl-3-(N-Boc)-4-ethynyl-oxazolidine is a versatile compound with significant implications in synthetic and medicinal chemistry.
Formula:C12H19NO3
InChI:InChI=1S/C12H19NO3/c1-7-9-8-15-12(5,6)13(9)10(14)16-11(2,3)4/h1,9H,8H2,2-6H3/t9-/m1/s1
InChI key:DPZQSYOKTUMHNY-SECBINFHSA-N
SMILES:CC1(N([C@@H](CO1)C#C)C(=O)OC(C)(C)C)C
Synonyms:
  • (R)-N-Boc-2,2-dimethyl-4-ethynyloxazolidine
Found 2 products.