CAS 16233-04-8
:N-(7-fluoro-3-nitro-9-oxo-fluoren-2-yl)acetamide
Description:
N-(7-fluoro-3-nitro-9-oxo-fluoren-2-yl)acetamide, with the CAS number 16233-04-8, is a chemical compound characterized by its complex structure, which includes a fluorenone moiety substituted with a fluorine atom and a nitro group. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, contributing to its potential reactivity and stability. The presence of the acetamide group suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with biological systems. The fluorine atom can enhance lipophilicity and may affect the compound's pharmacokinetic properties. Additionally, the nitro group is known for its electron-withdrawing effects, which can impact the compound's reactivity and potential applications in medicinal chemistry. Overall, this compound's unique structural features may make it of interest in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C15H9FN2O4
InChI:InChI=1/C15H9FN2O4/c1-7(19)17-13-5-12-10(6-14(13)18(21)22)9-3-2-8(16)4-11(9)15(12)20/h2-6H,1H3,(H,17,19)
SMILES:CC(=Nc1cc2c(cc1N(=O)=O)c1ccc(cc1C2=O)F)O
Synonyms:- N-(7-fluoro-3-nitro-9-oxo-9H-fluoren-2-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
